C29H35NO4 — CID 21046931
N-(2,2-dimethyl-4-phenyl-1,3-dioxan-5-yl)-5-[(2,3,4,5,6-pentamethylphenyl)methyl]furan-2-carboxamide (PubChem CID 21046931) has the molecular formula C29H35NO4 and a molecular weight of 461.60 g/mol. Its IUPAC name is N-(2,2-dimethyl-4-phenyl-1,3-dioxan-5-yl)-5-[(2,3,4,5,6-pentamethylphenyl)methyl]furan-2-carboxamide.
| Compound Name | N-(2,2-dimethyl-4-phenyl-1,3-dioxan-5-yl)-5-[(2,3,4,5,6-pentamethylphenyl)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 21046931 |
| Molecular Formula | C29H35NO4 |
| Molecular Weight | 461.60 g/mol |
| Exact Mass | 461.26 |
| IUPAC Name | N-(2,2-dimethyl-4-phenyl-1,3-dioxan-5-yl)-5-[(2,3,4,5,6-pentamethylphenyl)methyl]furan-2-carboxamide |
| SMILES | Cc1c(C)c(C)c(Cc2ccc(C(=O)NC3COC(C)(C)OC3c3ccccc3)o2)c(C)c1C |
| InChI | InChI=1S/C29H35NO4/c1-17-18(2)20(4)24(21(5)19(17)3)15-23-13-14-26(33-23)28(31)30-25-16-32-29(6,7)34-27(25)22-11-9-8-10-12-22/h8-14,25,27H,15-16H2,1-7H3,(H,30,31) |
| InChIKey | JZQXBWWROGCECD-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 60.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.60 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |