C33H38ClN5O2 — CID 21047518
N-[[3-[[(2-amino-6-chloropyrimidin-4-yl)amino]methyl]phenyl]methyl]-5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carboxamide (PubChem CID 21047518) has the molecular formula C33H38ClN5O2 and a molecular weight of 572.15 g/mol. Its IUPAC name is N-[[3-[[(2-amino-6-chloropyrimidin-4-yl)amino]methyl]phenyl]methyl]-5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carboxamide.
| Compound Name | N-[[3-[[(2-amino-6-chloropyrimidin-4-yl)amino]methyl]phenyl]methyl]-5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 21047518 |
| Molecular Formula | C33H38ClN5O2 |
| Molecular Weight | 572.15 g/mol |
| Exact Mass | 571.27 |
| IUPAC Name | N-[[3-[[(2-amino-6-chloropyrimidin-4-yl)amino]methyl]phenyl]methyl]-5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carboxamide |
| SMILES | Cc1cc2c(cc1Cc1ccc(C(=O)NCc3cccc(CNc4cc(Cl)nc(N)n4)c3)o1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C33H38ClN5O2/c1-20-13-25-26(33(4,5)12-11-32(25,2)3)16-23(20)15-24-9-10-27(41-24)30(40)37-19-22-8-6-7-21(14-22)18-36-29-17-28(34)38-31(35)39-29/h6-10,13-14,16-17H,11-12,15,18-19H2,1-5H3,(H,37,40)(H3,35,36,38,39) |
| InChIKey | ICPBJVSPUPQSIT-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 106.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.15 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |