C37H47N5O3 — CID 21047534
N-[[3-[[[4-(3-methoxypropylamino)pyrimidin-2-yl]amino]methyl]phenyl]methyl]-5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carboxamide (PubChem CID 21047534) has the molecular formula C37H47N5O3 and a molecular weight of 609.82 g/mol. Its IUPAC name is N-[[3-[[[4-(3-methoxypropylamino)pyrimidin-2-yl]amino]methyl]phenyl]methyl]-5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carboxamide.
| Compound Name | N-[[3-[[[4-(3-methoxypropylamino)pyrimidin-2-yl]amino]methyl]phenyl]methyl]-5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 21047534 |
| Molecular Formula | C37H47N5O3 |
| Molecular Weight | 609.82 g/mol |
| Exact Mass | 609.37 |
| IUPAC Name | N-[[3-[[[4-(3-methoxypropylamino)pyrimidin-2-yl]amino]methyl]phenyl]methyl]-5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carboxamide |
| SMILES | COCCCNc1ccnc(NCc2cccc(CNC(=O)c3ccc(Cc4cc5c(cc4C)C(C)(C)CCC5(C)C)o3)c2)n1 |
| InChI | InChI=1S/C37H47N5O3/c1-25-19-30-31(37(4,5)15-14-36(30,2)3)22-28(25)21-29-11-12-32(45-29)34(43)40-23-26-9-7-10-27(20-26)24-41-35-39-17-13-33(42-35)38-16-8-18-44-6/h7,9-13,17,19-20,22H,8,14-16,18,21,23-24H2,1-6H3,(H,40,43)(H2,38,39,41,42) |
| InChIKey | UVPPLEVRHDOMOU-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 101.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.82 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|