C33H38FN5O2 — CID 21047538
N-[[3-[[(4-amino-5-fluoropyrimidin-2-yl)amino]methyl]phenyl]methyl]-5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carboxamide (PubChem CID 21047538) has the molecular formula C33H38FN5O2 and a molecular weight of 555.70 g/mol. Its IUPAC name is N-[[3-[[(4-amino-5-fluoropyrimidin-2-yl)amino]methyl]phenyl]methyl]-5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carboxamide.
| Compound Name | N-[[3-[[(4-amino-5-fluoropyrimidin-2-yl)amino]methyl]phenyl]methyl]-5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 21047538 |
| Molecular Formula | C33H38FN5O2 |
| Molecular Weight | 555.70 g/mol |
| Exact Mass | 555.30 |
| IUPAC Name | N-[[3-[[(4-amino-5-fluoropyrimidin-2-yl)amino]methyl]phenyl]methyl]-5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carboxamide |
| SMILES | Cc1cc2c(cc1Cc1ccc(C(=O)NCc3cccc(CNc4ncc(F)c(N)n4)c3)o1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C33H38FN5O2/c1-20-13-25-26(33(4,5)12-11-32(25,2)3)16-23(20)15-24-9-10-28(41-24)30(40)36-17-21-7-6-8-22(14-21)18-37-31-38-19-27(34)29(35)39-31/h6-10,13-14,16,19H,11-12,15,17-18H2,1-5H3,(H,36,40)(H3,35,37,38,39) |
| InChIKey | OSXXVJZENJHFIS-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 106.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.70 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |