C37H45N5O3 — CID 21047583
N-[[3-[[(4-morpholin-4-ylpyrimidin-2-yl)amino]methyl]phenyl]methyl]-5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carboxamide (PubChem CID 21047583) has the molecular formula C37H45N5O3 and a molecular weight of 607.80 g/mol. Its IUPAC name is N-[[3-[[(4-morpholin-4-ylpyrimidin-2-yl)amino]methyl]phenyl]methyl]-5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carboxamide.
| Compound Name | N-[[3-[[(4-morpholin-4-ylpyrimidin-2-yl)amino]methyl]phenyl]methyl]-5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 21047583 |
| Molecular Formula | C37H45N5O3 |
| Molecular Weight | 607.80 g/mol |
| Exact Mass | 607.35 |
| IUPAC Name | N-[[3-[[(4-morpholin-4-ylpyrimidin-2-yl)amino]methyl]phenyl]methyl]-5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carboxamide |
| SMILES | Cc1cc2c(cc1Cc1ccc(C(=O)NCc3cccc(CNc4nccc(N5CCOCC5)n4)c3)o1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C37H45N5O3/c1-25-19-30-31(37(4,5)13-12-36(30,2)3)22-28(25)21-29-9-10-32(45-29)34(43)39-23-26-7-6-8-27(20-26)24-40-35-38-14-11-33(41-35)42-15-17-44-18-16-42/h6-11,14,19-20,22H,12-13,15-18,21,23-24H2,1-5H3,(H,39,43)(H,38,40,41) |
| InChIKey | UXLPSQVGLDDXQU-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 92.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.80 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |