C14H11BrN2O2S — CID 2104761
N-(6-bromo-3-ethyl-1,3-benzothiazol-2-ylidene)furan-2-carboxamide (PubChem CID 2104761) has the molecular formula C14H11BrN2O2S and a molecular weight of 351.23 g/mol. Its IUPAC name is N-(6-bromo-3-ethyl-1,3-benzothiazol-2-ylidene)furan-2-carboxamide.
| Compound Name | N-(6-bromo-3-ethyl-1,3-benzothiazol-2-ylidene)furan-2-carboxamide |
|---|---|
| PubChem CID | 2104761 |
| Molecular Formula | C14H11BrN2O2S |
| Molecular Weight | 351.23 g/mol |
| Exact Mass | 349.97 |
| IUPAC Name | N-(6-bromo-3-ethyl-1,3-benzothiazol-2-ylidene)furan-2-carboxamide |
| SMILES | CCn1/c(=N/C(=O)c2ccco2)sc2cc(Br)ccc21 |
| InChI | InChI=1S/C14H11BrN2O2S/c1-2-17-10-6-5-9(15)8-12(10)20-14(17)16-13(18)11-4-3-7-19-11/h3-8H,2H2,1H3/b16-14- |
| InChIKey | HMVOLCRMTFBSTD-PEZBUJJGSA-N |
| XLogP | 3.82 |
| TPSA | 47.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.23 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |