C11H13FN2O2S — CID 21048513
3-tert-butyl-7-fluoro-4H-1λ6,2,4-benzothiadiazine 1,1-dioxide (PubChem CID 21048513) has the molecular formula C11H13FN2O2S and a molecular weight of 256.30 g/mol. Its IUPAC name is 3-tert-butyl-7-fluoro-4H-1λ6,2,4-benzothiadiazine 1,1-dioxide.
| Compound Name | 3-tert-butyl-7-fluoro-4H-1λ6,2,4-benzothiadiazine 1,1-dioxide |
|---|---|
| PubChem CID | 21048513 |
| Molecular Formula | C11H13FN2O2S |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | 3-tert-butyl-7-fluoro-4H-1λ6,2,4-benzothiadiazine 1,1-dioxide |
| SMILES | CC(C)(C)C1=NS(=O)(=O)c2cc(F)ccc2N1 |
| InChI | InChI=1S/C11H13FN2O2S/c1-11(2,3)10-13-8-5-4-7(12)6-9(8)17(15,16)14-10/h4-6H,1-3H3,(H,13,14) |
| InChIKey | GCVMYNOEHOLCFW-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |