About 3-tert-butyl-5-methyl-1,2-thiazole 1,1-dioxide
3-tert-butyl-5-methyl-1,2-thiazole 1,1-dioxide (PubChem CID 21048558) has the molecular formula C8H13NO2S
and a molecular weight of 187.26 g/mol. Its IUPAC name is 3-tert-butyl-5-methyl-1,2-thiazole 1,1-dioxide.
Molecular Properties
| Compound Name | 3-tert-butyl-5-methyl-1,2-thiazole 1,1-dioxide |
| PubChem CID | 21048558 |
| Molecular Formula | C8H13NO2S |
| Molecular Weight | 187.26 g/mol |
| Exact Mass | 187.07 |
| IUPAC Name | 3-tert-butyl-5-methyl-1,2-thiazole 1,1-dioxide |
| SMILES | CC1=CC(C(C)(C)C)=NS1(=O)=O |
| InChI | InChI=1S/C8H13NO2S/c1-6-5-7(8(2,3)4)9-12(6,10)11/h5H,1-4H3 |
| InChIKey | XKSBZYGUKUSQAD-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.26 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-tert-butyl-5-methyl-1,2-thiazole 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-tert-butyl-5-methyl-1,2-thiazole 1,1-dioxide?
The IUPAC name of 3-tert-butyl-5-methyl-1,2-thiazole 1,1-dioxide (CID 21048558) is 3-tert-butyl-5-methyl-1,2-thiazole 1,1-dioxide.
What is the SMILES notation for 3-tert-butyl-5-methyl-1,2-thiazole 1,1-dioxide?
The canonical SMILES for 3-tert-butyl-5-methyl-1,2-thiazole 1,1-dioxide is CC1=CC(C(C)(C)C)=NS1(=O)=O.
What is the InChIKey of 3-tert-butyl-5-methyl-1,2-thiazole 1,1-dioxide?
The InChIKey is XKSBZYGUKUSQAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NO2S/c1-6-5-7(8(2,3)4)9-12(6,10)11/h5H,1-4H3.
What are the key properties of 3-tert-butyl-5-methyl-1,2-thiazole 1,1-dioxide?
3-tert-butyl-5-methyl-1,2-thiazole 1,1-dioxide has a molecular weight of 187.26 g/mol, XLogP of 1.72, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-tert-butyl-5-methyl-1,2-thiazole 1,1-dioxide is sourced from PubChem (CID 21048558), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).