C25H22N4O2 — CID 21048674
tert-butyl 2-(6-pyridin-3-yl-1H-indazol-3-yl)indole-1-carboxylate (PubChem CID 21048674) has the molecular formula C25H22N4O2 and a molecular weight of 410.48 g/mol. Its IUPAC name is tert-butyl 2-(6-pyridin-3-yl-1H-indazol-3-yl)indole-1-carboxylate.
| Compound Name | tert-butyl 2-(6-pyridin-3-yl-1H-indazol-3-yl)indole-1-carboxylate |
|---|---|
| PubChem CID | 21048674 |
| Molecular Formula | C25H22N4O2 |
| Molecular Weight | 410.48 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | tert-butyl 2-(6-pyridin-3-yl-1H-indazol-3-yl)indole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1c(-c2n[nH]c3cc(-c4cccnc4)ccc23)cc2ccccc21 |
| InChI | InChI=1S/C25H22N4O2/c1-25(2,3)31-24(30)29-21-9-5-4-7-17(21)14-22(29)23-19-11-10-16(13-20(19)27-28-23)18-8-6-12-26-15-18/h4-15H,1-3H3,(H,27,28) |
| InChIKey | MVBLKPGLYHECDI-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.48 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |