C23H31NO2S — CID 21048816
1-[4-(benzenesulfonyl)-4-methylpentyl]-3-phenylpiperidine (PubChem CID 21048816) has the molecular formula C23H31NO2S and a molecular weight of 385.57 g/mol. Its IUPAC name is 1-[4-(benzenesulfonyl)-4-methylpentyl]-3-phenylpiperidine.
| Compound Name | 1-[4-(benzenesulfonyl)-4-methylpentyl]-3-phenylpiperidine |
|---|---|
| PubChem CID | 21048816 |
| Molecular Formula | C23H31NO2S |
| Molecular Weight | 385.57 g/mol |
| Exact Mass | 385.21 |
| IUPAC Name | 1-[4-(benzenesulfonyl)-4-methylpentyl]-3-phenylpiperidine |
| SMILES | CC(C)(CCCN1CCCC(c2ccccc2)C1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C23H31NO2S/c1-23(2,27(25,26)22-14-7-4-8-15-22)16-10-18-24-17-9-13-21(19-24)20-11-5-3-6-12-20/h3-8,11-12,14-15,21H,9-10,13,16-19H2,1-2H3 |
| InChIKey | OSLJYKCMMISVMB-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.57 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |