About [5-[4-(dimethylamino)phenyl]-2-(3-fluoro-4-hydroxyphenyl)-3,6-dimethoxyphenyl] methanesulfonate
[5-[4-(dimethylamino)phenyl]-2-(3-fluoro-4-hydroxyphenyl)-3,6-dimethoxyphenyl] methanesulfonate (PubChem CID 21049276) has the molecular formula C23H24FNO6S
and a molecular weight of 461.51 g/mol. Its IUPAC name is [5-[4-(dimethylamino)phenyl]-2-(3-fluoro-4-hydroxyphenyl)-3,6-dimethoxyphenyl] methanesulfonate.
Molecular Properties
| Compound Name | [5-[4-(dimethylamino)phenyl]-2-(3-fluoro-4-hydroxyphenyl)-3,6-dimethoxyphenyl] methanesulfonate |
| PubChem CID | 21049276 |
| Molecular Formula | C23H24FNO6S |
| Molecular Weight | 461.51 g/mol |
| Exact Mass | 461.13 |
| IUPAC Name | [5-[4-(dimethylamino)phenyl]-2-(3-fluoro-4-hydroxyphenyl)-3,6-dimethoxyphenyl] methanesulfonate |
| SMILES | COc1cc(-c2ccc(N(C)C)cc2)c(OC)c(OS(C)(=O)=O)c1-c1ccc(O)c(F)c1 |
| InChI | InChI=1S/C23H24FNO6S/c1-25(2)16-9-6-14(7-10-16)17-13-20(29-3)21(15-8-11-19(26)18(24)12-15)23(22(17)30-4)31-32(5,27)28/h6-13,26H,1-5H3 |
| InChIKey | PLBUESXZGJSQGD-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 461.51 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [5-[4-(dimethylamino)phenyl]-2-(3-fluoro-4-hydroxyphenyl)-3,6-dimethoxyphenyl] methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-[4-(dimethylamino)phenyl]-2-(3-fluoro-4-hydroxyphenyl)-3,6-dimethoxyphenyl] methanesulfonate?
The IUPAC name of [5-[4-(dimethylamino)phenyl]-2-(3-fluoro-4-hydroxyphenyl)-3,6-dimethoxyphenyl] methanesulfonate (CID 21049276) is [5-[4-(dimethylamino)phenyl]-2-(3-fluoro-4-hydroxyphenyl)-3,6-dimethoxyphenyl] methanesulfonate.
What is the SMILES notation for [5-[4-(dimethylamino)phenyl]-2-(3-fluoro-4-hydroxyphenyl)-3,6-dimethoxyphenyl] methanesulfonate?
The canonical SMILES for [5-[4-(dimethylamino)phenyl]-2-(3-fluoro-4-hydroxyphenyl)-3,6-dimethoxyphenyl] methanesulfonate is COc1cc(-c2ccc(N(C)C)cc2)c(OC)c(OS(C)(=O)=O)c1-c1ccc(O)c(F)c1.
What is the InChIKey of [5-[4-(dimethylamino)phenyl]-2-(3-fluoro-4-hydroxyphenyl)-3,6-dimethoxyphenyl] methanesulfonate?
The InChIKey is PLBUESXZGJSQGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H24FNO6S/c1-25(2)16-9-6-14(7-10-16)17-13-20(29-3)21(15-8-11-19(26)18(24)12-15)23(22(17)30-4)31-32(5,27)28/h6-13,26H,1-5H3.
What are the key properties of [5-[4-(dimethylamino)phenyl]-2-(3-fluoro-4-hydroxyphenyl)-3,6-dimethoxyphenyl] methanesulfonate?
[5-[4-(dimethylamino)phenyl]-2-(3-fluoro-4-hydroxyphenyl)-3,6-dimethoxyphenyl] methanesulfonate has a molecular weight of 461.51 g/mol, XLogP of 4.29, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [5-[4-(dimethylamino)phenyl]-2-(3-fluoro-4-hydroxyphenyl)-3,6-dimethoxyphenyl] methanesulfonate is sourced from PubChem (CID 21049276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).