C27H27FO7S — CID 21049300
[4-[5-[3-fluoro-4-(3-methylbut-2-enoxy)phenyl]-6-methoxy-2,3-dihydro-1,4-benzodioxin-8-yl]phenyl] methanesulfonate (PubChem CID 21049300) has the molecular formula C27H27FO7S and a molecular weight of 514.57 g/mol. Its IUPAC name is [4-[5-[3-fluoro-4-(3-methylbut-2-enoxy)phenyl]-6-methoxy-2,3-dihydro-1,4-benzodioxin-8-yl]phenyl] methanesulfonate.
| Compound Name | [4-[5-[3-fluoro-4-(3-methylbut-2-enoxy)phenyl]-6-methoxy-2,3-dihydro-1,4-benzodioxin-8-yl]phenyl] methanesulfonate |
|---|---|
| PubChem CID | 21049300 |
| Molecular Formula | C27H27FO7S |
| Molecular Weight | 514.57 g/mol |
| Exact Mass | 514.15 |
| IUPAC Name | [4-[5-[3-fluoro-4-(3-methylbut-2-enoxy)phenyl]-6-methoxy-2,3-dihydro-1,4-benzodioxin-8-yl]phenyl] methanesulfonate |
| SMILES | COc1cc(-c2ccc(OS(C)(=O)=O)cc2)c2c(c1-c1ccc(OCC=C(C)C)c(F)c1)OCCO2 |
| InChI | InChI=1S/C27H27FO7S/c1-17(2)11-12-32-23-10-7-19(15-22(23)28)25-24(31-3)16-21(26-27(25)34-14-13-33-26)18-5-8-20(9-6-18)35-36(4,29)30/h5-11,15-16H,12-14H2,1-4H3 |
| InChIKey | RKZCYFJRQKZPCD-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.57 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|