C31H34FN7O3 — CID 21049460
3-[[4-[4-[[1-[(3-fluorophenyl)methyl]indazol-5-yl]amino]pyrrolo[2,1-f][1,2,4]triazin-5-yl]oxycyclohexyl]amino]-2,2-dimethylpropanoic acid (PubChem CID 21049460) has the molecular formula C31H34FN7O3 and a molecular weight of 571.66 g/mol. Its IUPAC name is 3-[[4-[4-[[1-[(3-fluorophenyl)methyl]indazol-5-yl]amino]pyrrolo[2,1-f][1,2,4]triazin-5-yl]oxycyclohexyl]amino]-2,2-dimethylpropanoic acid.
| Compound Name | 3-[[4-[4-[[1-[(3-fluorophenyl)methyl]indazol-5-yl]amino]pyrrolo[2,1-f][1,2,4]triazin-5-yl]oxycyclohexyl]amino]-2,2-dimethylpropanoic acid |
|---|---|
| PubChem CID | 21049460 |
| Molecular Formula | C31H34FN7O3 |
| Molecular Weight | 571.66 g/mol |
| Exact Mass | 571.27 |
| IUPAC Name | 3-[[4-[4-[[1-[(3-fluorophenyl)methyl]indazol-5-yl]amino]pyrrolo[2,1-f][1,2,4]triazin-5-yl]oxycyclohexyl]amino]-2,2-dimethylpropanoic acid |
| SMILES | CC(C)(CNC1CCC(Oc2ccn3ncnc(Nc4ccc5c(cnn5Cc5cccc(F)c5)c4)c23)CC1)C(=O)O |
| InChI | InChI=1S/C31H34FN7O3/c1-31(2,30(40)41)18-33-23-6-9-25(10-7-23)42-27-12-13-38-28(27)29(34-19-36-38)37-24-8-11-26-21(15-24)16-35-39(26)17-20-4-3-5-22(32)14-20/h3-5,8,11-16,19,23,25,33H,6-7,9-10,17-18H2,1-2H3,(H,40,41)(H,34,36,37) |
| InChIKey | AQEDJUKOVQYPFO-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 118.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.66 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |