C27H25FN8O — CID 21049487
N-[1-[(3-fluorophenyl)methyl]indazol-5-yl]-5-[4-(isocyanoamino)cyclohexyl]oxypyrrolo[2,1-f][1,2,4]triazin-4-amine (PubChem CID 21049487) has the molecular formula C27H25FN8O and a molecular weight of 496.55 g/mol. Its IUPAC name is N-[1-[(3-fluorophenyl)methyl]indazol-5-yl]-5-[4-(isocyanoamino)cyclohexyl]oxypyrrolo[2,1-f][1,2,4]triazin-4-amine.
| Compound Name | N-[1-[(3-fluorophenyl)methyl]indazol-5-yl]-5-[4-(isocyanoamino)cyclohexyl]oxypyrrolo[2,1-f][1,2,4]triazin-4-amine |
|---|---|
| PubChem CID | 21049487 |
| Molecular Formula | C27H25FN8O |
| Molecular Weight | 496.55 g/mol |
| Exact Mass | 496.21 |
| IUPAC Name | N-[1-[(3-fluorophenyl)methyl]indazol-5-yl]-5-[4-(isocyanoamino)cyclohexyl]oxypyrrolo[2,1-f][1,2,4]triazin-4-amine |
| SMILES | [C-]#[N+]NC1CCC(Oc2ccn3ncnc(Nc4ccc5c(cnn5Cc5cccc(F)c5)c4)c23)CC1 |
| InChI | InChI=1S/C27H25FN8O/c1-29-34-21-5-8-23(9-6-21)37-25-11-12-35-26(25)27(30-17-32-35)33-22-7-10-24-19(14-22)15-31-36(24)16-18-3-2-4-20(28)13-18/h2-4,7,10-15,17,21,23,34H,5-6,8-9,16H2,(H,30,32,33) |
| InChIKey | YVTDLXLVHJYDEV-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 85.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.55 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|