About 2-ethylhexyl 2-(oxan-2-ylsulfanyl)acetate
2-ethylhexyl 2-(oxan-2-ylsulfanyl)acetate (PubChem CID 21049669) has the molecular formula C15H28O3S
and a molecular weight of 288.45 g/mol. Its IUPAC name is 2-ethylhexyl 2-(oxan-2-ylsulfanyl)acetate.
Molecular Properties
| Compound Name | 2-ethylhexyl 2-(oxan-2-ylsulfanyl)acetate |
| PubChem CID | 21049669 |
| Molecular Formula | C15H28O3S |
| Molecular Weight | 288.45 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | 2-ethylhexyl 2-(oxan-2-ylsulfanyl)acetate |
| SMILES | CCCCC(CC)COC(=O)CSC1CCCCO1 |
| InChI | InChI=1S/C15H28O3S/c1-3-5-8-13(4-2)11-18-14(16)12-19-15-9-6-7-10-17-15/h13,15H,3-12H2,1-2H3 |
| InChIKey | ZBJLNUHXTGBBHN-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.45 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-ethylhexyl 2-(oxan-2-ylsulfanyl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylhexyl 2-(oxan-2-ylsulfanyl)acetate?
The IUPAC name of 2-ethylhexyl 2-(oxan-2-ylsulfanyl)acetate (CID 21049669) is 2-ethylhexyl 2-(oxan-2-ylsulfanyl)acetate.
What is the SMILES notation for 2-ethylhexyl 2-(oxan-2-ylsulfanyl)acetate?
The canonical SMILES for 2-ethylhexyl 2-(oxan-2-ylsulfanyl)acetate is CCCCC(CC)COC(=O)CSC1CCCCO1.
What is the InChIKey of 2-ethylhexyl 2-(oxan-2-ylsulfanyl)acetate?
The InChIKey is ZBJLNUHXTGBBHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28O3S/c1-3-5-8-13(4-2)11-18-14(16)12-19-15-9-6-7-10-17-15/h13,15H,3-12H2,1-2H3.
What are the key properties of 2-ethylhexyl 2-(oxan-2-ylsulfanyl)acetate?
2-ethylhexyl 2-(oxan-2-ylsulfanyl)acetate has a molecular weight of 288.45 g/mol, XLogP of 4.01, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylhexyl 2-(oxan-2-ylsulfanyl)acetate is sourced from PubChem (CID 21049669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).