C13H4BrF7O — CID 21049705
5-bromo-2-[difluoro-(3,4,5-trifluorophenoxy)methyl]-1,3-difluorobenzene (PubChem CID 21049705) has the molecular formula C13H4BrF7O and a molecular weight of 389.06 g/mol. Its IUPAC name is 5-bromo-2-[difluoro-(3,4,5-trifluorophenoxy)methyl]-1,3-difluorobenzene.
| Compound Name | 5-bromo-2-[difluoro-(3,4,5-trifluorophenoxy)methyl]-1,3-difluorobenzene |
|---|---|
| PubChem CID | 21049705 |
| Molecular Formula | C13H4BrF7O |
| Molecular Weight | 389.06 g/mol |
| Exact Mass | 387.93 |
| IUPAC Name | 5-bromo-2-[difluoro-(3,4,5-trifluorophenoxy)methyl]-1,3-difluorobenzene |
| SMILES | Fc1cc(OC(F)(F)c2c(F)cc(Br)cc2F)cc(F)c1F |
| InChI | InChI=1S/C13H4BrF7O/c14-5-1-7(15)11(8(16)2-5)13(20,21)22-6-3-9(17)12(19)10(18)4-6/h1-4H |
| InChIKey | SHRYZLBRADLPQN-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.06 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|