About 4-methoxy-4-phenyloxane
4-methoxy-4-phenyloxane (PubChem CID 21049814) has the molecular formula C12H16O2
and a molecular weight of 192.26 g/mol. Its IUPAC name is 4-methoxy-4-phenyloxane.
Molecular Properties
| Compound Name | 4-methoxy-4-phenyloxane |
| PubChem CID | 21049814 |
| Molecular Formula | C12H16O2 |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.12 |
| IUPAC Name | 4-methoxy-4-phenyloxane |
| SMILES | COC1(c2ccccc2)CCOCC1 |
| InChI | InChI=1S/C12H16O2/c1-13-12(7-9-14-10-8-12)11-5-3-2-4-6-11/h2-6H,7-10H2,1H3 |
| InChIKey | GLABGBLXQSJODC-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-methoxy-4-phenyloxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-4-phenyloxane?
The IUPAC name of 4-methoxy-4-phenyloxane (CID 21049814) is 4-methoxy-4-phenyloxane.
What is the SMILES notation for 4-methoxy-4-phenyloxane?
The canonical SMILES for 4-methoxy-4-phenyloxane is COC1(c2ccccc2)CCOCC1.
What is the InChIKey of 4-methoxy-4-phenyloxane?
The InChIKey is GLABGBLXQSJODC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O2/c1-13-12(7-9-14-10-8-12)11-5-3-2-4-6-11/h2-6H,7-10H2,1H3.
What are the key properties of 4-methoxy-4-phenyloxane?
4-methoxy-4-phenyloxane has a molecular weight of 192.26 g/mol, XLogP of 2.34, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-4-phenyloxane is sourced from PubChem (CID 21049814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).