C18H28O3 — CID 21049832
2-hydroxypropyl 9,10-dimethyltetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate (PubChem CID 21049832) has the molecular formula C18H28O3 and a molecular weight of 292.42 g/mol. Its IUPAC name is 2-hydroxypropyl 9,10-dimethyltetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate.
| Compound Name | 2-hydroxypropyl 9,10-dimethyltetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate |
|---|---|
| PubChem CID | 21049832 |
| Molecular Formula | C18H28O3 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | 2-hydroxypropyl 9,10-dimethyltetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate |
| SMILES | CC(O)COC(=O)C1CC2CC1C1C3CC(C(C)C3C)C21 |
| InChI | InChI=1S/C18H28O3/c1-8(19)7-21-18(20)15-5-11-4-14(15)17-13-6-12(16(11)17)9(2)10(13)3/h8-17,19H,4-7H2,1-3H3 |
| InChIKey | IJKVEVMQVLSLPB-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'} |
|---|