C14H20F7NO — CID 21049855
N-ethyl-N-[7,8,8,8-tetrafluoro-7-(trifluoromethyl)octyl]prop-2-enamide (PubChem CID 21049855) has the molecular formula C14H20F7NO and a molecular weight of 351.31 g/mol. Its IUPAC name is N-ethyl-N-[7,8,8,8-tetrafluoro-7-(trifluoromethyl)octyl]prop-2-enamide.
| Compound Name | N-ethyl-N-[7,8,8,8-tetrafluoro-7-(trifluoromethyl)octyl]prop-2-enamide |
|---|---|
| PubChem CID | 21049855 |
| Molecular Formula | C14H20F7NO |
| Molecular Weight | 351.31 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | N-ethyl-N-[7,8,8,8-tetrafluoro-7-(trifluoromethyl)octyl]prop-2-enamide |
| SMILES | C=CC(=O)N(CC)CCCCCCC(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C14H20F7NO/c1-3-11(23)22(4-2)10-8-6-5-7-9-12(15,13(16,17)18)14(19,20)21/h3H,1,4-10H2,2H3 |
| InChIKey | VHMAVHDFXZMIPS-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.31 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|