C8H12N6S — CID 21049971
3-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-4-methyl-1H-1,2,4-triazole-5-thione (PubChem CID 21049971) has the molecular formula C8H12N6S and a molecular weight of 224.29 g/mol. Its IUPAC name is 3-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-4-methyl-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-4-methyl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 21049971 |
| Molecular Formula | C8H12N6S |
| Molecular Weight | 224.29 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | 3-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-4-methyl-1H-1,2,4-triazole-5-thione |
| SMILES | Cc1nnc(Cc2n[nH]c(=S)n2C)n1C |
| InChI | InChI=1S/C8H12N6S/c1-5-9-10-6(13(5)2)4-7-11-12-8(15)14(7)3/h4H2,1-3H3,(H,12,15) |
| InChIKey | BYMNZBOVEWEGDY-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 64.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.29 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|