C26H35N5O3S2 — CID 21050274
[4-(2-ethylsulfanyl-5-methylperoxysulfanylbenzimidazol-1-yl)piperidin-1-yl]-[1-(1H-pyrrol-3-ylmethyl)piperidin-4-yl]methanone (PubChem CID 21050274) has the molecular formula C26H35N5O3S2 and a molecular weight of 529.73 g/mol. Its IUPAC name is [4-(2-ethylsulfanyl-5-methylperoxysulfanylbenzimidazol-1-yl)piperidin-1-yl]-[1-(1H-pyrrol-3-ylmethyl)piperidin-4-yl]methanone.
| Compound Name | [4-(2-ethylsulfanyl-5-methylperoxysulfanylbenzimidazol-1-yl)piperidin-1-yl]-[1-(1H-pyrrol-3-ylmethyl)piperidin-4-yl]methanone |
|---|---|
| PubChem CID | 21050274 |
| Molecular Formula | C26H35N5O3S2 |
| Molecular Weight | 529.73 g/mol |
| Exact Mass | 529.22 |
| IUPAC Name | [4-(2-ethylsulfanyl-5-methylperoxysulfanylbenzimidazol-1-yl)piperidin-1-yl]-[1-(1H-pyrrol-3-ylmethyl)piperidin-4-yl]methanone |
| SMILES | CCSc1nc2cc(SOOC)ccc2n1C1CCN(C(=O)C2CCN(Cc3cc[nH]c3)CC2)CC1 |
| InChI | InChI=1S/C26H35N5O3S2/c1-3-35-26-28-23-16-22(36-34-33-2)4-5-24(23)31(26)21-9-14-30(15-10-21)25(32)20-7-12-29(13-8-20)18-19-6-11-27-17-19/h4-6,11,16-17,20-21,27H,3,7-10,12-15,18H2,1-2H3 |
| InChIKey | FNQZJUPFJQNCBR-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 75.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.73 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|