About 2-(4-methanidyl-3-methoxyphenyl)-5,6-dihydro-4H-indene;yttrium(3+)
2-(4-methanidyl-3-methoxyphenyl)-5,6-dihydro-4H-indene;yttrium(3+) (PubChem CID 21050960) has the molecular formula C17H17OY+2
and a molecular weight of 326.23 g/mol. Its IUPAC name is 2-(4-methanidyl-3-methoxyphenyl)-5,6-dihydro-4H-indene;yttrium(3+).
Molecular Properties
| Compound Name | 2-(4-methanidyl-3-methoxyphenyl)-5,6-dihydro-4H-indene;yttrium(3+) |
| PubChem CID | 21050960 |
| Molecular Formula | C17H17OY+2 |
| Molecular Weight | 326.23 g/mol |
| Exact Mass | 326.03 |
| IUPAC Name | 2-(4-methanidyl-3-methoxyphenyl)-5,6-dihydro-4H-indene;yttrium(3+) |
| SMILES | [CH2-]c1ccc(C2=CC3=CCCCC3=C2)cc1OC.[Y+3] |
| InChI | InChI=1S/C17H17O.Y/c1-12-7-8-15(11-17(12)18-2)16-9-13-5-3-4-6-14(13)10-16;/h5,7-11H,1,3-4,6H2,2H3;/q-1;+3 |
| InChIKey | BTPDRZWVDZKWFT-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.23 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-methanidyl-3-methoxyphenyl)-5,6-dihydro-4H-indene;yttrium(3+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-methanidyl-3-methoxyphenyl)-5,6-dihydro-4H-indene;yttrium(3+)?
The IUPAC name of 2-(4-methanidyl-3-methoxyphenyl)-5,6-dihydro-4H-indene;yttrium(3+) (CID 21050960) is 2-(4-methanidyl-3-methoxyphenyl)-5,6-dihydro-4H-indene;yttrium(3+).
What is the SMILES notation for 2-(4-methanidyl-3-methoxyphenyl)-5,6-dihydro-4H-indene;yttrium(3+)?
The canonical SMILES for 2-(4-methanidyl-3-methoxyphenyl)-5,6-dihydro-4H-indene;yttrium(3+) is [CH2-]c1ccc(C2=CC3=CCCCC3=C2)cc1OC.[Y+3].
What is the InChIKey of 2-(4-methanidyl-3-methoxyphenyl)-5,6-dihydro-4H-indene;yttrium(3+)?
The InChIKey is BTPDRZWVDZKWFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17O.Y/c1-12-7-8-15(11-17(12)18-2)16-9-13-5-3-4-6-14(13)10-16;/h5,7-11H,1,3-4,6H2,2H3;/q-1;+3.
What are the key properties of 2-(4-methanidyl-3-methoxyphenyl)-5,6-dihydro-4H-indene;yttrium(3+)?
2-(4-methanidyl-3-methoxyphenyl)-5,6-dihydro-4H-indene;yttrium(3+) has a molecular weight of 326.23 g/mol, XLogP of 4.31, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methanidyl-3-methoxyphenyl)-5,6-dihydro-4H-indene;yttrium(3+) is sourced from PubChem (CID 21050960), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).