About dipotassium;N-dimethyl-N-(3-oxo-6-trimethylsilylhex-5-ynyl)boronamidic acid
dipotassium;N-dimethyl-N-(3-oxo-6-trimethylsilylhex-5-ynyl)boronamidic acid (PubChem CID 21051152) has the molecular formula C11H21BK2NO2Si+
and a molecular weight of 316.39 g/mol. Its IUPAC name is dipotassium;N-dimethyl-N-(3-oxo-6-trimethylsilylhex-5-ynyl)boronamidic acid.
Molecular Properties
| Compound Name | dipotassium;N-dimethyl-N-(3-oxo-6-trimethylsilylhex-5-ynyl)boronamidic acid |
| PubChem CID | 21051152 |
| Molecular Formula | C11H21BK2NO2Si+ |
| Molecular Weight | 316.39 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | dipotassium;N-dimethyl-N-(3-oxo-6-trimethylsilylhex-5-ynyl)boronamidic acid |
| SMILES | CB(O)N(C)[CH-]CC(=O)CC#C[Si](C)(C)C.[K+].[K+] |
| InChI | InChI=1S/C11H21BNO2Si.2K/c1-12(15)13(2)9-8-11(14)7-6-10-16(3,4)5;;/h9,15H,7-8H2,1-5H3;;/q-1;2*+1 |
| InChIKey | YOGADWPYLUQUHR-UHFFFAOYSA-N |
| XLogP | -4.57 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.39 |
| LogP ≤ 5 | -4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze dipotassium;N-dimethyl-N-(3-oxo-6-trimethylsilylhex-5-ynyl)boronamidic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dipotassium;N-dimethyl-N-(3-oxo-6-trimethylsilylhex-5-ynyl)boronamidic acid?
The IUPAC name of dipotassium;N-dimethyl-N-(3-oxo-6-trimethylsilylhex-5-ynyl)boronamidic acid (CID 21051152) is dipotassium;N-dimethyl-N-(3-oxo-6-trimethylsilylhex-5-ynyl)boronamidic acid.
What is the SMILES notation for dipotassium;N-dimethyl-N-(3-oxo-6-trimethylsilylhex-5-ynyl)boronamidic acid?
The canonical SMILES for dipotassium;N-dimethyl-N-(3-oxo-6-trimethylsilylhex-5-ynyl)boronamidic acid is CB(O)N(C)[CH-]CC(=O)CC#C[Si](C)(C)C.[K+].[K+].
What is the InChIKey of dipotassium;N-dimethyl-N-(3-oxo-6-trimethylsilylhex-5-ynyl)boronamidic acid?
The InChIKey is YOGADWPYLUQUHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21BNO2Si.2K/c1-12(15)13(2)9-8-11(14)7-6-10-16(3,4)5;;/h9,15H,7-8H2,1-5H3;;/q-1;2*+1.
What are the key properties of dipotassium;N-dimethyl-N-(3-oxo-6-trimethylsilylhex-5-ynyl)boronamidic acid?
dipotassium;N-dimethyl-N-(3-oxo-6-trimethylsilylhex-5-ynyl)boronamidic acid has a molecular weight of 316.39 g/mol, XLogP of -4.57, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dipotassium;N-dimethyl-N-(3-oxo-6-trimethylsilylhex-5-ynyl)boronamidic acid is sourced from PubChem (CID 21051152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).