C14H27N3 — CID 21051458
1,3,5-tritert-butyl-1,2,4-triazole (PubChem CID 21051458) has the molecular formula C14H27N3 and a molecular weight of 237.39 g/mol. Its IUPAC name is 1,3,5-tritert-butyl-1,2,4-triazole.
| Compound Name | 1,3,5-tritert-butyl-1,2,4-triazole |
|---|---|
| PubChem CID | 21051458 |
| Molecular Formula | C14H27N3 |
| Molecular Weight | 237.39 g/mol |
| Exact Mass | 237.22 |
| IUPAC Name | 1,3,5-tritert-butyl-1,2,4-triazole |
| SMILES | CC(C)(C)c1nc(C(C)(C)C)n(C(C)(C)C)n1 |
| InChI | InChI=1S/C14H27N3/c1-12(2,3)10-15-11(13(4,5)6)17(16-10)14(7,8)9/h1-9H3 |
| InChIKey | AIMQVJRCRDMZAH-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.39 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |