About 2-[3,5-dibromo-4-[2-(2,6-dibromo-4-methylphenyl)propan-2-yl]phenoxy]-1-methoxyethanol
2-[3,5-dibromo-4-[2-(2,6-dibromo-4-methylphenyl)propan-2-yl]phenoxy]-1-methoxyethanol (PubChem CID 21051632) has the molecular formula C19H20Br4O3
and a molecular weight of 615.98 g/mol. Its IUPAC name is 2-[3,5-dibromo-4-[2-(2,6-dibromo-4-methylphenyl)propan-2-yl]phenoxy]-1-methoxyethanol.
Molecular Properties
| Compound Name | 2-[3,5-dibromo-4-[2-(2,6-dibromo-4-methylphenyl)propan-2-yl]phenoxy]-1-methoxyethanol |
| PubChem CID | 21051632 |
| Molecular Formula | C19H20Br4O3 |
| Molecular Weight | 615.98 g/mol |
| Exact Mass | 611.81 |
| IUPAC Name | 2-[3,5-dibromo-4-[2-(2,6-dibromo-4-methylphenyl)propan-2-yl]phenoxy]-1-methoxyethanol |
| SMILES | COC(O)COc1cc(Br)c(C(C)(C)c2c(Br)cc(C)cc2Br)c(Br)c1 |
| InChI | InChI=1S/C19H20Br4O3/c1-10-5-12(20)17(13(21)6-10)19(2,3)18-14(22)7-11(8-15(18)23)26-9-16(24)25-4/h5-8,16,24H,9H2,1-4H3 |
| InChIKey | IPAGDARDNKRFJE-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 615.98 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-[3,5-dibromo-4-[2-(2,6-dibromo-4-methylphenyl)propan-2-yl]phenoxy]-1-methoxyethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3,5-dibromo-4-[2-(2,6-dibromo-4-methylphenyl)propan-2-yl]phenoxy]-1-methoxyethanol?
The IUPAC name of 2-[3,5-dibromo-4-[2-(2,6-dibromo-4-methylphenyl)propan-2-yl]phenoxy]-1-methoxyethanol (CID 21051632) is 2-[3,5-dibromo-4-[2-(2,6-dibromo-4-methylphenyl)propan-2-yl]phenoxy]-1-methoxyethanol.
What is the SMILES notation for 2-[3,5-dibromo-4-[2-(2,6-dibromo-4-methylphenyl)propan-2-yl]phenoxy]-1-methoxyethanol?
The canonical SMILES for 2-[3,5-dibromo-4-[2-(2,6-dibromo-4-methylphenyl)propan-2-yl]phenoxy]-1-methoxyethanol is COC(O)COc1cc(Br)c(C(C)(C)c2c(Br)cc(C)cc2Br)c(Br)c1.
What is the InChIKey of 2-[3,5-dibromo-4-[2-(2,6-dibromo-4-methylphenyl)propan-2-yl]phenoxy]-1-methoxyethanol?
The InChIKey is IPAGDARDNKRFJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20Br4O3/c1-10-5-12(20)17(13(21)6-10)19(2,3)18-14(22)7-11(8-15(18)23)26-9-16(24)25-4/h5-8,16,24H,9H2,1-4H3.
What are the key properties of 2-[3,5-dibromo-4-[2-(2,6-dibromo-4-methylphenyl)propan-2-yl]phenoxy]-1-methoxyethanol?
2-[3,5-dibromo-4-[2-(2,6-dibromo-4-methylphenyl)propan-2-yl]phenoxy]-1-methoxyethanol has a molecular weight of 615.98 g/mol, XLogP of 6.71, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3,5-dibromo-4-[2-(2,6-dibromo-4-methylphenyl)propan-2-yl]phenoxy]-1-methoxyethanol is sourced from PubChem (CID 21051632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).