About CID 21051679
CID 21051679 (PubChem CID 21051679) has the molecular formula C43H45AlN4O3+
and a molecular weight of 692.84 g/mol.
Molecular Properties
| Compound Name | CID 21051679 |
| PubChem CID | 21051679 |
| Molecular Formula | C43H45AlN4O3+ |
| Molecular Weight | 692.84 g/mol |
| Exact Mass | 692.33 |
| IUPAC Name | — |
| SMILES | C=CC1CC(C=C)C(CCCCCCNCc2ccc(O[n+]3cccc4cccc(O[Al]Oc5cccc6cccnc56)c43)c3ncccc23)C1 |
| InChI | InChI=1S/C34H39N3O2.C9H7NO.Al/c1-3-25-22-26(4-2)28(23-25)12-7-5-6-8-19-35-24-29-17-18-32(33-30(29)15-10-20-36-33)39-37-21-11-14-27-13-9-16-31(38)34(27)37;11-8-5-1-3-7-4-2-6-10-9(7)8;/h3-4,9-11,13-18,20-21,25-26,28,35H,1-2,5-8,12,19,22-24H2;1-6,11H;/q;;+2/p-1 |
| InChIKey | CYQVUOYOIHOYKA-UHFFFAOYSA-M |
| XLogP | 9.11 |
| TPSA | 69.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 51 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 692.84 |
| LogP ≤ 5 | 9.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze CID 21051679 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 21051679?
The IUPAC name of CID 21051679 (CID 21051679) is not available.
What is the SMILES notation for CID 21051679?
The canonical SMILES for CID 21051679 is C=CC1CC(C=C)C(CCCCCCNCc2ccc(O[n+]3cccc4cccc(O[Al]Oc5cccc6cccnc56)c43)c3ncccc23)C1.
What is the InChIKey of CID 21051679?
The InChIKey is CYQVUOYOIHOYKA-UHFFFAOYSA-M. The full InChI is InChI=1S/C34H39N3O2.C9H7NO.Al/c1-3-25-22-26(4-2)28(23-25)12-7-5-6-8-19-35-24-29-17-18-32(33-30(29)15-10-20-36-33)39-37-21-11-14-27-13-9-16-31(38)34(27)37;11-8-5-1-3-7-4-2-6-10-9(7)8;/h3-4,9-11,13-18,20-21,25-26,28,35H,1-2,5-8,12,19,22-24H2;1-6,11H;/q;;+2/p-1.
What are the key properties of CID 21051679?
CID 21051679 has a molecular weight of 692.84 g/mol, XLogP of 9.11, 17 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 21051679 is sourced from PubChem (CID 21051679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).