C7H7F4O2- — CID 21051686
(E)-4,4,5,5-tetrafluoro-2-methylhex-2-enoate (PubChem CID 21051686) has the molecular formula C7H7F4O2- and a molecular weight of 199.12 g/mol. Its IUPAC name is (E)-4,4,5,5-tetrafluoro-2-methylhex-2-enoate.
| Compound Name | (E)-4,4,5,5-tetrafluoro-2-methylhex-2-enoate |
|---|---|
| PubChem CID | 21051686 |
| Molecular Formula | C7H7F4O2- |
| Molecular Weight | 199.12 g/mol |
| Exact Mass | 199.04 |
| IUPAC Name | (E)-4,4,5,5-tetrafluoro-2-methylhex-2-enoate |
| SMILES | C/C(=C\C(F)(F)C(C)(F)F)C(=O)[O-] |
| InChI | InChI=1S/C7H8F4O2/c1-4(5(12)13)3-7(10,11)6(2,8)9/h3H,1-2H3,(H,12,13)/p-1/b4-3+ |
| InChIKey | OLQYJKWLZQLFRZ-ONEGZZNKSA-M |
| XLogP | 0.97 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.12 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|