C18H16F12O4 — CID 21051691
1-ethenyl-3,5-bis[1,1,1,3,3,3-hexafluoro-2-(methoxymethoxy)propan-2-yl]benzene (PubChem CID 21051691) has the molecular formula C18H16F12O4 and a molecular weight of 524.30 g/mol. Its IUPAC name is 1-ethenyl-3,5-bis[1,1,1,3,3,3-hexafluoro-2-(methoxymethoxy)propan-2-yl]benzene.
| Compound Name | 1-ethenyl-3,5-bis[1,1,1,3,3,3-hexafluoro-2-(methoxymethoxy)propan-2-yl]benzene |
|---|---|
| PubChem CID | 21051691 |
| Molecular Formula | C18H16F12O4 |
| Molecular Weight | 524.30 g/mol |
| Exact Mass | 524.09 |
| IUPAC Name | 1-ethenyl-3,5-bis[1,1,1,3,3,3-hexafluoro-2-(methoxymethoxy)propan-2-yl]benzene |
| SMILES | C=Cc1cc(C(OCOC)(C(F)(F)F)C(F)(F)F)cc(C(OCOC)(C(F)(F)F)C(F)(F)F)c1 |
| InChI | InChI=1S/C18H16F12O4/c1-4-10-5-11(13(15(19,20)21,16(22,23)24)33-8-31-2)7-12(6-10)14(17(25,26)27,18(28,29)30)34-9-32-3/h4-7H,1,8-9H2,2-3H3 |
| InChIKey | QWDDVONXPPYBGZ-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.30 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|