C8H6F10O2 — CID 21052204
1,1,2,2-tetrafluoro-1-(2,2,2-trifluoroethoxy)-3-(1,1,2-trifluoroprop-2-enoxy)propane (PubChem CID 21052204) has the molecular formula C8H6F10O2 and a molecular weight of 324.11 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-1-(2,2,2-trifluoroethoxy)-3-(1,1,2-trifluoroprop-2-enoxy)propane.
| Compound Name | 1,1,2,2-tetrafluoro-1-(2,2,2-trifluoroethoxy)-3-(1,1,2-trifluoroprop-2-enoxy)propane |
|---|---|
| PubChem CID | 21052204 |
| Molecular Formula | C8H6F10O2 |
| Molecular Weight | 324.11 g/mol |
| Exact Mass | 324.02 |
| IUPAC Name | 1,1,2,2-tetrafluoro-1-(2,2,2-trifluoroethoxy)-3-(1,1,2-trifluoroprop-2-enoxy)propane |
| SMILES | C=C(F)C(F)(F)OCC(F)(F)C(F)(F)OCC(F)(F)F |
| InChI | InChI=1S/C8H6F10O2/c1-4(9)7(15,16)19-2-5(10,11)8(17,18)20-3-6(12,13)14/h1-3H2 |
| InChIKey | DSBRRJZOGCUOLN-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.11 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|