About 1-[difluoro(2,3,3-trifluorobutan-2-yloxy)methoxy]-2-methylbutane
1-[difluoro(2,3,3-trifluorobutan-2-yloxy)methoxy]-2-methylbutane (PubChem CID 21052207) has the molecular formula C10H17F5O2
and a molecular weight of 264.23 g/mol. Its IUPAC name is 1-[difluoro(2,3,3-trifluorobutan-2-yloxy)methoxy]-2-methylbutane.
Molecular Properties
| Compound Name | 1-[difluoro(2,3,3-trifluorobutan-2-yloxy)methoxy]-2-methylbutane |
| PubChem CID | 21052207 |
| Molecular Formula | C10H17F5O2 |
| Molecular Weight | 264.23 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | 1-[difluoro(2,3,3-trifluorobutan-2-yloxy)methoxy]-2-methylbutane |
| SMILES | CCC(C)COC(F)(F)OC(C)(F)C(C)(F)F |
| InChI | InChI=1S/C10H17F5O2/c1-5-7(2)6-16-10(14,15)17-9(4,13)8(3,11)12/h7H,5-6H2,1-4H3 |
| InChIKey | GQJWRAJMNFTXOH-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.23 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-[difluoro(2,3,3-trifluorobutan-2-yloxy)methoxy]-2-methylbutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[difluoro(2,3,3-trifluorobutan-2-yloxy)methoxy]-2-methylbutane?
The IUPAC name of 1-[difluoro(2,3,3-trifluorobutan-2-yloxy)methoxy]-2-methylbutane (CID 21052207) is 1-[difluoro(2,3,3-trifluorobutan-2-yloxy)methoxy]-2-methylbutane.
What is the SMILES notation for 1-[difluoro(2,3,3-trifluorobutan-2-yloxy)methoxy]-2-methylbutane?
The canonical SMILES for 1-[difluoro(2,3,3-trifluorobutan-2-yloxy)methoxy]-2-methylbutane is CCC(C)COC(F)(F)OC(C)(F)C(C)(F)F.
What is the InChIKey of 1-[difluoro(2,3,3-trifluorobutan-2-yloxy)methoxy]-2-methylbutane?
The InChIKey is GQJWRAJMNFTXOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17F5O2/c1-5-7(2)6-16-10(14,15)17-9(4,13)8(3,11)12/h7H,5-6H2,1-4H3.
What are the key properties of 1-[difluoro(2,3,3-trifluorobutan-2-yloxy)methoxy]-2-methylbutane?
1-[difluoro(2,3,3-trifluorobutan-2-yloxy)methoxy]-2-methylbutane has a molecular weight of 264.23 g/mol, XLogP of 3.96, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[difluoro(2,3,3-trifluorobutan-2-yloxy)methoxy]-2-methylbutane is sourced from PubChem (CID 21052207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).