About 2-ethoxy-3H-isoquinoline
2-ethoxy-3H-isoquinoline (PubChem CID 21052215) has the molecular formula C11H13NO
and a molecular weight of 175.23 g/mol. Its IUPAC name is 2-ethoxy-3H-isoquinoline.
Molecular Properties
| Compound Name | 2-ethoxy-3H-isoquinoline |
| PubChem CID | 21052215 |
| Molecular Formula | C11H13NO |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.10 |
| IUPAC Name | 2-ethoxy-3H-isoquinoline |
| SMILES | CCON1C=c2ccccc2=CC1 |
| InChI | InChI=1S/C11H13NO/c1-2-13-12-8-7-10-5-3-4-6-11(10)9-12/h3-7,9H,2,8H2,1H3 |
| InChIKey | HDHSINLUAKSLDN-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-ethoxy-3H-isoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxy-3H-isoquinoline?
The IUPAC name of 2-ethoxy-3H-isoquinoline (CID 21052215) is 2-ethoxy-3H-isoquinoline.
What is the SMILES notation for 2-ethoxy-3H-isoquinoline?
The canonical SMILES for 2-ethoxy-3H-isoquinoline is CCON1C=c2ccccc2=CC1.
What is the InChIKey of 2-ethoxy-3H-isoquinoline?
The InChIKey is HDHSINLUAKSLDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO/c1-2-13-12-8-7-10-5-3-4-6-11(10)9-12/h3-7,9H,2,8H2,1H3.
What are the key properties of 2-ethoxy-3H-isoquinoline?
2-ethoxy-3H-isoquinoline has a molecular weight of 175.23 g/mol, XLogP of 0.47, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxy-3H-isoquinoline is sourced from PubChem (CID 21052215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).