C28H23N13S — CID 21052236
1-(1,3-benzothiazol-2-yl)-3-methyl-5-[[4-methyl-2,6-bis[(5-methylpyrimidin-4-yl)amino]-3-pyridinyl]diazenyl]pyrazole-4-carbonitrile (PubChem CID 21052236) has the molecular formula C28H23N13S and a molecular weight of 573.65 g/mol. Its IUPAC name is 1-(1,3-benzothiazol-2-yl)-3-methyl-5-[[4-methyl-2,6-bis[(5-methylpyrimidin-4-yl)amino]-3-pyridinyl]diazenyl]pyrazole-4-carbonitrile.
| Compound Name | 1-(1,3-benzothiazol-2-yl)-3-methyl-5-[[4-methyl-2,6-bis[(5-methylpyrimidin-4-yl)amino]-3-pyridinyl]diazenyl]pyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 21052236 |
| Molecular Formula | C28H23N13S |
| Molecular Weight | 573.65 g/mol |
| Exact Mass | 573.19 |
| IUPAC Name | 1-(1,3-benzothiazol-2-yl)-3-methyl-5-[[4-methyl-2,6-bis[(5-methylpyrimidin-4-yl)amino]-3-pyridinyl]diazenyl]pyrazole-4-carbonitrile |
| SMILES | Cc1cncnc1Nc1cc(C)c(/N=N/c2c(C#N)c(C)nn2-c2nc3ccccc3s2)c(Nc2ncncc2C)n1 |
| InChI | InChI=1S/C28H23N13S/c1-15-9-22(35-24-16(2)11-30-13-32-24)36-26(37-25-17(3)12-31-14-33-25)23(15)38-39-27-19(10-29)18(4)40-41(27)28-34-20-7-5-6-8-21(20)42-28/h5-9,11-14H,1-4H3,(H2,30,31,32,33,35,36,37)/b39-38+ |
| InChIKey | VAXUJIQRFDINAE-YMZYAJTMSA-N |
| XLogP | 6.46 |
| TPSA | 167.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.65 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|