About sodium 3-(3-isocyano-5-methyl-1,2,4-triazol-1-yl)propane-1-sulfonate
sodium 3-(3-isocyano-5-methyl-1,2,4-triazol-1-yl)propane-1-sulfonate (PubChem CID 21052281) has the molecular formula C7H9N4NaO3S
and a molecular weight of 252.23 g/mol. Its IUPAC name is sodium 3-(3-isocyano-5-methyl-1,2,4-triazol-1-yl)propane-1-sulfonate.
Molecular Properties
| Compound Name | sodium 3-(3-isocyano-5-methyl-1,2,4-triazol-1-yl)propane-1-sulfonate |
| PubChem CID | 21052281 |
| Molecular Formula | C7H9N4NaO3S |
| Molecular Weight | 252.23 g/mol |
| Exact Mass | 252.03 |
| IUPAC Name | sodium 3-(3-isocyano-5-methyl-1,2,4-triazol-1-yl)propane-1-sulfonate |
| SMILES | [C-]#[N+]c1nc(C)n(CCCS(=O)(=O)[O-])n1.[Na+] |
| InChI | InChI=1S/C7H10N4O3S.Na/c1-6-9-7(8-2)10-11(6)4-3-5-15(12,13)14;/h3-5H2,1H3,(H,12,13,14);/q;+1/p-1 |
| InChIKey | ZIMCMUXWIWRFKY-UHFFFAOYSA-M |
| XLogP | -2.92 |
| TPSA | 92.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.23 |
| LogP ≤ 5 | -2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze sodium 3-(3-isocyano-5-methyl-1,2,4-triazol-1-yl)propane-1-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 3-(3-isocyano-5-methyl-1,2,4-triazol-1-yl)propane-1-sulfonate?
The IUPAC name of sodium 3-(3-isocyano-5-methyl-1,2,4-triazol-1-yl)propane-1-sulfonate (CID 21052281) is sodium 3-(3-isocyano-5-methyl-1,2,4-triazol-1-yl)propane-1-sulfonate.
What is the SMILES notation for sodium 3-(3-isocyano-5-methyl-1,2,4-triazol-1-yl)propane-1-sulfonate?
The canonical SMILES for sodium 3-(3-isocyano-5-methyl-1,2,4-triazol-1-yl)propane-1-sulfonate is [C-]#[N+]c1nc(C)n(CCCS(=O)(=O)[O-])n1.[Na+].
What is the InChIKey of sodium 3-(3-isocyano-5-methyl-1,2,4-triazol-1-yl)propane-1-sulfonate?
The InChIKey is ZIMCMUXWIWRFKY-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H10N4O3S.Na/c1-6-9-7(8-2)10-11(6)4-3-5-15(12,13)14;/h3-5H2,1H3,(H,12,13,14);/q;+1/p-1.
What are the key properties of sodium 3-(3-isocyano-5-methyl-1,2,4-triazol-1-yl)propane-1-sulfonate?
sodium 3-(3-isocyano-5-methyl-1,2,4-triazol-1-yl)propane-1-sulfonate has a molecular weight of 252.23 g/mol, XLogP of -2.92, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 3-(3-isocyano-5-methyl-1,2,4-triazol-1-yl)propane-1-sulfonate is sourced from PubChem (CID 21052281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).