About 3,5-dimethyl-1-(1,3-thiazol-2-yl)pyrazole-4-carbonitrile
3,5-dimethyl-1-(1,3-thiazol-2-yl)pyrazole-4-carbonitrile (PubChem CID 21052286) has the molecular formula C9H8N4S
and a molecular weight of 204.26 g/mol. Its IUPAC name is 3,5-dimethyl-1-(1,3-thiazol-2-yl)pyrazole-4-carbonitrile.
Molecular Properties
| Compound Name | 3,5-dimethyl-1-(1,3-thiazol-2-yl)pyrazole-4-carbonitrile |
| PubChem CID | 21052286 |
| Molecular Formula | C9H8N4S |
| Molecular Weight | 204.26 g/mol |
| Exact Mass | 204.05 |
| IUPAC Name | 3,5-dimethyl-1-(1,3-thiazol-2-yl)pyrazole-4-carbonitrile |
| SMILES | Cc1nn(-c2nccs2)c(C)c1C#N |
| InChI | InChI=1S/C9H8N4S/c1-6-8(5-10)7(2)13(12-6)9-11-3-4-14-9/h3-4H,1-2H3 |
| InChIKey | HYLGODNZNZMIRS-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 54.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.26 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3,5-dimethyl-1-(1,3-thiazol-2-yl)pyrazole-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dimethyl-1-(1,3-thiazol-2-yl)pyrazole-4-carbonitrile?
The IUPAC name of 3,5-dimethyl-1-(1,3-thiazol-2-yl)pyrazole-4-carbonitrile (CID 21052286) is 3,5-dimethyl-1-(1,3-thiazol-2-yl)pyrazole-4-carbonitrile.
What is the SMILES notation for 3,5-dimethyl-1-(1,3-thiazol-2-yl)pyrazole-4-carbonitrile?
The canonical SMILES for 3,5-dimethyl-1-(1,3-thiazol-2-yl)pyrazole-4-carbonitrile is Cc1nn(-c2nccs2)c(C)c1C#N.
What is the InChIKey of 3,5-dimethyl-1-(1,3-thiazol-2-yl)pyrazole-4-carbonitrile?
The InChIKey is HYLGODNZNZMIRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N4S/c1-6-8(5-10)7(2)13(12-6)9-11-3-4-14-9/h3-4H,1-2H3.
What are the key properties of 3,5-dimethyl-1-(1,3-thiazol-2-yl)pyrazole-4-carbonitrile?
3,5-dimethyl-1-(1,3-thiazol-2-yl)pyrazole-4-carbonitrile has a molecular weight of 204.26 g/mol, XLogP of 1.82, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dimethyl-1-(1,3-thiazol-2-yl)pyrazole-4-carbonitrile is sourced from PubChem (CID 21052286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).