About potassium 3-(5-methyl-1,3,4-thiadiazol-2-yl)benzenesulfonate
potassium 3-(5-methyl-1,3,4-thiadiazol-2-yl)benzenesulfonate (PubChem CID 21052290) has the molecular formula C9H7KN2O3S2
and a molecular weight of 294.40 g/mol. Its IUPAC name is potassium 3-(5-methyl-1,3,4-thiadiazol-2-yl)benzenesulfonate.
Molecular Properties
| Compound Name | potassium 3-(5-methyl-1,3,4-thiadiazol-2-yl)benzenesulfonate |
| PubChem CID | 21052290 |
| Molecular Formula | C9H7KN2O3S2 |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 293.95 |
| IUPAC Name | potassium 3-(5-methyl-1,3,4-thiadiazol-2-yl)benzenesulfonate |
| SMILES | Cc1nnc(-c2cccc(S(=O)(=O)[O-])c2)s1.[K+] |
| InChI | InChI=1S/C9H8N2O3S2.K/c1-6-10-11-9(15-6)7-3-2-4-8(5-7)16(12,13)14;/h2-5H,1H3,(H,12,13,14);/q;+1/p-1 |
| InChIKey | SHZUVJRGMUMTGB-UHFFFAOYSA-M |
| XLogP | -1.58 |
| TPSA | 82.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | -1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze potassium 3-(5-methyl-1,3,4-thiadiazol-2-yl)benzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium 3-(5-methyl-1,3,4-thiadiazol-2-yl)benzenesulfonate?
The IUPAC name of potassium 3-(5-methyl-1,3,4-thiadiazol-2-yl)benzenesulfonate (CID 21052290) is potassium 3-(5-methyl-1,3,4-thiadiazol-2-yl)benzenesulfonate.
What is the SMILES notation for potassium 3-(5-methyl-1,3,4-thiadiazol-2-yl)benzenesulfonate?
The canonical SMILES for potassium 3-(5-methyl-1,3,4-thiadiazol-2-yl)benzenesulfonate is Cc1nnc(-c2cccc(S(=O)(=O)[O-])c2)s1.[K+].
What is the InChIKey of potassium 3-(5-methyl-1,3,4-thiadiazol-2-yl)benzenesulfonate?
The InChIKey is SHZUVJRGMUMTGB-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H8N2O3S2.K/c1-6-10-11-9(15-6)7-3-2-4-8(5-7)16(12,13)14;/h2-5H,1H3,(H,12,13,14);/q;+1/p-1.
What are the key properties of potassium 3-(5-methyl-1,3,4-thiadiazol-2-yl)benzenesulfonate?
potassium 3-(5-methyl-1,3,4-thiadiazol-2-yl)benzenesulfonate has a molecular weight of 294.40 g/mol, XLogP of -1.58, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for potassium 3-(5-methyl-1,3,4-thiadiazol-2-yl)benzenesulfonate is sourced from PubChem (CID 21052290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).