About 5-methyl-3-(2-methylperoxyprop-2-enylsulfanyl)-1,2,4-thiadiazole
5-methyl-3-(2-methylperoxyprop-2-enylsulfanyl)-1,2,4-thiadiazole (PubChem CID 21052344) has the molecular formula C7H10N2O2S2
and a molecular weight of 218.30 g/mol. Its IUPAC name is 5-methyl-3-(2-methylperoxyprop-2-enylsulfanyl)-1,2,4-thiadiazole.
Molecular Properties
| Compound Name | 5-methyl-3-(2-methylperoxyprop-2-enylsulfanyl)-1,2,4-thiadiazole |
| PubChem CID | 21052344 |
| Molecular Formula | C7H10N2O2S2 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.02 |
| IUPAC Name | 5-methyl-3-(2-methylperoxyprop-2-enylsulfanyl)-1,2,4-thiadiazole |
| SMILES | C=C(CSc1nsc(C)n1)OOC |
| InChI | InChI=1S/C7H10N2O2S2/c1-5(11-10-3)4-12-7-8-6(2)13-9-7/h1,4H2,2-3H3 |
| InChIKey | ZHZICENSHOIBEW-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 5-methyl-3-(2-methylperoxyprop-2-enylsulfanyl)-1,2,4-thiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-3-(2-methylperoxyprop-2-enylsulfanyl)-1,2,4-thiadiazole?
The IUPAC name of 5-methyl-3-(2-methylperoxyprop-2-enylsulfanyl)-1,2,4-thiadiazole (CID 21052344) is 5-methyl-3-(2-methylperoxyprop-2-enylsulfanyl)-1,2,4-thiadiazole.
What is the SMILES notation for 5-methyl-3-(2-methylperoxyprop-2-enylsulfanyl)-1,2,4-thiadiazole?
The canonical SMILES for 5-methyl-3-(2-methylperoxyprop-2-enylsulfanyl)-1,2,4-thiadiazole is C=C(CSc1nsc(C)n1)OOC.
What is the InChIKey of 5-methyl-3-(2-methylperoxyprop-2-enylsulfanyl)-1,2,4-thiadiazole?
The InChIKey is ZHZICENSHOIBEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O2S2/c1-5(11-10-3)4-12-7-8-6(2)13-9-7/h1,4H2,2-3H3.
What are the key properties of 5-methyl-3-(2-methylperoxyprop-2-enylsulfanyl)-1,2,4-thiadiazole?
5-methyl-3-(2-methylperoxyprop-2-enylsulfanyl)-1,2,4-thiadiazole has a molecular weight of 218.30 g/mol, XLogP of 2.03, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-3-(2-methylperoxyprop-2-enylsulfanyl)-1,2,4-thiadiazole is sourced from PubChem (CID 21052344), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).