C18H24N6O9S4 — CID 21052357
2-[[5-[[2-acetamido-4-[bis(3-sulfopropyl)amino]phenyl]diazenyl]-1,3,4-thiadiazol-2-yl]sulfanyl]acetic acid (PubChem CID 21052357) has the molecular formula C18H24N6O9S4 and a molecular weight of 596.69 g/mol. Its IUPAC name is 2-[[5-[[2-acetamido-4-[bis(3-sulfopropyl)amino]phenyl]diazenyl]-1,3,4-thiadiazol-2-yl]sulfanyl]acetic acid.
| Compound Name | 2-[[5-[[2-acetamido-4-[bis(3-sulfopropyl)amino]phenyl]diazenyl]-1,3,4-thiadiazol-2-yl]sulfanyl]acetic acid |
|---|---|
| PubChem CID | 21052357 |
| Molecular Formula | C18H24N6O9S4 |
| Molecular Weight | 596.69 g/mol |
| Exact Mass | 596.05 |
| IUPAC Name | 2-[[5-[[2-acetamido-4-[bis(3-sulfopropyl)amino]phenyl]diazenyl]-1,3,4-thiadiazol-2-yl]sulfanyl]acetic acid |
| SMILES | CC(=O)Nc1cc(N(CCCS(=O)(=O)O)CCCS(=O)(=O)O)ccc1/N=N/c1nnc(SCC(=O)O)s1 |
| InChI | InChI=1S/C18H24N6O9S4/c1-12(25)19-15-10-13(24(6-2-8-36(28,29)30)7-3-9-37(31,32)33)4-5-14(15)20-21-17-22-23-18(35-17)34-11-16(26)27/h4-5,10H,2-3,6-9,11H2,1H3,(H,19,25)(H,26,27)(H,28,29,30)(H,31,32,33)/b21-20+ |
| InChIKey | BOWHBXKRPONYSN-QZQOTICOSA-N |
| XLogP | 2.45 |
| TPSA | 228.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.69 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|