C28H26F4O2 — CID 21052887
(3,4,5-trifluorophenyl) 2-fluoro-4-[4-(2-phenylpropyl)cyclohexyl]benzoate (PubChem CID 21052887) has the molecular formula C28H26F4O2 and a molecular weight of 470.51 g/mol. Its IUPAC name is (3,4,5-trifluorophenyl) 2-fluoro-4-[4-(2-phenylpropyl)cyclohexyl]benzoate.
| Compound Name | (3,4,5-trifluorophenyl) 2-fluoro-4-[4-(2-phenylpropyl)cyclohexyl]benzoate |
|---|---|
| PubChem CID | 21052887 |
| Molecular Formula | C28H26F4O2 |
| Molecular Weight | 470.51 g/mol |
| Exact Mass | 470.19 |
| IUPAC Name | (3,4,5-trifluorophenyl) 2-fluoro-4-[4-(2-phenylpropyl)cyclohexyl]benzoate |
| SMILES | CC(CC1CCC(c2ccc(C(=O)Oc3cc(F)c(F)c(F)c3)c(F)c2)CC1)c1ccccc1 |
| InChI | InChI=1S/C28H26F4O2/c1-17(19-5-3-2-4-6-19)13-18-7-9-20(10-8-18)21-11-12-23(24(29)14-21)28(33)34-22-15-25(30)27(32)26(31)16-22/h2-6,11-12,14-18,20H,7-10,13H2,1H3 |
| InChIKey | IOKSGNJRLQCQEB-UHFFFAOYSA-N |
| XLogP | 7.93 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.51 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|