About 1,4-dimethylbenzene-3,5-diide;heptakis(yttrium)
1,4-dimethylbenzene-3,5-diide;heptakis(yttrium) (PubChem CID 21053143) has the molecular formula C8H8Y7-2
and a molecular weight of 726.49 g/mol. Its IUPAC name is 1,4-dimethylbenzene-3,5-diide;heptakis(yttrium).
Molecular Properties
| Compound Name | 1,4-dimethylbenzene-3,5-diide;heptakis(yttrium) |
| PubChem CID | 21053143 |
| Molecular Formula | C8H8Y7-2 |
| Molecular Weight | 726.49 g/mol |
| Exact Mass | 726.40 |
| IUPAC Name | 1,4-dimethylbenzene-3,5-diide;heptakis(yttrium) |
| SMILES | Cc1[c-]cc(C)c[c-]1.[Y].[Y].[Y].[Y].[Y].[Y].[Y] |
| InChI | InChI=1S/C8H8.7Y/c1-7-3-5-8(2)6-4-7;;;;;;;/h3-4H,1-2H3;;;;;;;/q-2;;;;;;; |
| InChIKey | XBNKXOGIXYUCKF-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 726.49 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 1,4-dimethylbenzene-3,5-diide;heptakis(yttrium) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dimethylbenzene-3,5-diide;heptakis(yttrium)?
The IUPAC name of 1,4-dimethylbenzene-3,5-diide;heptakis(yttrium) (CID 21053143) is 1,4-dimethylbenzene-3,5-diide;heptakis(yttrium).
What is the SMILES notation for 1,4-dimethylbenzene-3,5-diide;heptakis(yttrium)?
The canonical SMILES for 1,4-dimethylbenzene-3,5-diide;heptakis(yttrium) is Cc1[c-]cc(C)c[c-]1.[Y].[Y].[Y].[Y].[Y].[Y].[Y].
What is the InChIKey of 1,4-dimethylbenzene-3,5-diide;heptakis(yttrium)?
The InChIKey is XBNKXOGIXYUCKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8.7Y/c1-7-3-5-8(2)6-4-7;;;;;;;/h3-4H,1-2H3;;;;;;;/q-2;;;;;;;.
What are the key properties of 1,4-dimethylbenzene-3,5-diide;heptakis(yttrium)?
1,4-dimethylbenzene-3,5-diide;heptakis(yttrium) has a molecular weight of 726.49 g/mol, XLogP of 1.89, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dimethylbenzene-3,5-diide;heptakis(yttrium) is sourced from PubChem (CID 21053143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).