About 2-ethenyl-9,9-dimethylfluorene
2-ethenyl-9,9-dimethylfluorene (PubChem CID 21053262) has the molecular formula C17H16
and a molecular weight of 220.31 g/mol. Its IUPAC name is 2-ethenyl-9,9-dimethylfluorene.
Molecular Properties
| Compound Name | 2-ethenyl-9,9-dimethylfluorene |
| PubChem CID | 21053262 |
| Molecular Formula | C17H16 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | 2-ethenyl-9,9-dimethylfluorene |
| SMILES | C=Cc1ccc2c(c1)C(C)(C)c1ccccc1-2 |
| InChI | InChI=1S/C17H16/c1-4-12-9-10-14-13-7-5-6-8-15(13)17(2,3)16(14)11-12/h4-11H,1H2,2-3H3 |
| InChIKey | SXMBSZQMZAFGII-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-ethenyl-9,9-dimethylfluorene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethenyl-9,9-dimethylfluorene?
The IUPAC name of 2-ethenyl-9,9-dimethylfluorene (CID 21053262) is 2-ethenyl-9,9-dimethylfluorene.
What is the SMILES notation for 2-ethenyl-9,9-dimethylfluorene?
The canonical SMILES for 2-ethenyl-9,9-dimethylfluorene is C=Cc1ccc2c(c1)C(C)(C)c1ccccc1-2.
What is the InChIKey of 2-ethenyl-9,9-dimethylfluorene?
The InChIKey is SXMBSZQMZAFGII-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16/c1-4-12-9-10-14-13-7-5-6-8-15(13)17(2,3)16(14)11-12/h4-11H,1H2,2-3H3.
What are the key properties of 2-ethenyl-9,9-dimethylfluorene?
2-ethenyl-9,9-dimethylfluorene has a molecular weight of 220.31 g/mol, XLogP of 4.64, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethenyl-9,9-dimethylfluorene is sourced from PubChem (CID 21053262), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).