About 5-(4-ethenylphenoxy)pyridine-2-carboxylic acid;2-phenylpyridine;platinum
5-(4-ethenylphenoxy)pyridine-2-carboxylic acid;2-phenylpyridine;platinum (PubChem CID 21053270) has the molecular formula C25H19N2O3Pt-
and a molecular weight of 590.52 g/mol. Its IUPAC name is 5-(4-ethenylphenoxy)pyridine-2-carboxylic acid;2-phenylpyridine;platinum.
Molecular Properties
| Compound Name | 5-(4-ethenylphenoxy)pyridine-2-carboxylic acid;2-phenylpyridine;platinum |
| PubChem CID | 21053270 |
| Molecular Formula | C25H19N2O3Pt- |
| Molecular Weight | 590.52 g/mol |
| Exact Mass | 590.10 |
| IUPAC Name | 5-(4-ethenylphenoxy)pyridine-2-carboxylic acid;2-phenylpyridine;platinum |
| SMILES | C=Cc1ccc(Oc2ccc(C(=O)O)nc2)cc1.[Pt].[c-]1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C14H11NO3.C11H8N.Pt/c1-2-10-3-5-11(6-4-10)18-12-7-8-13(14(16)17)15-9-12;1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h2-9H,1H2,(H,16,17);1-6,8-9H;/q;-1; |
| InChIKey | APKLBJARPZIYSF-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 72.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 590.52 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 5-(4-ethenylphenoxy)pyridine-2-carboxylic acid;2-phenylpyridine;platinum with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-ethenylphenoxy)pyridine-2-carboxylic acid;2-phenylpyridine;platinum?
The IUPAC name of 5-(4-ethenylphenoxy)pyridine-2-carboxylic acid;2-phenylpyridine;platinum (CID 21053270) is 5-(4-ethenylphenoxy)pyridine-2-carboxylic acid;2-phenylpyridine;platinum.
What is the SMILES notation for 5-(4-ethenylphenoxy)pyridine-2-carboxylic acid;2-phenylpyridine;platinum?
The canonical SMILES for 5-(4-ethenylphenoxy)pyridine-2-carboxylic acid;2-phenylpyridine;platinum is C=Cc1ccc(Oc2ccc(C(=O)O)nc2)cc1.[Pt].[c-]1ccccc1-c1ccccn1.
What is the InChIKey of 5-(4-ethenylphenoxy)pyridine-2-carboxylic acid;2-phenylpyridine;platinum?
The InChIKey is APKLBJARPZIYSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11NO3.C11H8N.Pt/c1-2-10-3-5-11(6-4-10)18-12-7-8-13(14(16)17)15-9-12;1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h2-9H,1H2,(H,16,17);1-6,8-9H;/q;-1;.
What are the key properties of 5-(4-ethenylphenoxy)pyridine-2-carboxylic acid;2-phenylpyridine;platinum?
5-(4-ethenylphenoxy)pyridine-2-carboxylic acid;2-phenylpyridine;platinum has a molecular weight of 590.52 g/mol, XLogP of 5.76, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-ethenylphenoxy)pyridine-2-carboxylic acid;2-phenylpyridine;platinum is sourced from PubChem (CID 21053270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).