C24H36F12O4 — CID 21053294
1-butan-2-yl-3,5-bis[2-(1-ethoxyethoxy)-1,1,1,3,3,3-hexafluoropropan-2-yl]cyclohexane (PubChem CID 21053294) has the molecular formula C24H36F12O4 and a molecular weight of 616.52 g/mol. Its IUPAC name is 1-butan-2-yl-3,5-bis[2-(1-ethoxyethoxy)-1,1,1,3,3,3-hexafluoropropan-2-yl]cyclohexane.
| Compound Name | 1-butan-2-yl-3,5-bis[2-(1-ethoxyethoxy)-1,1,1,3,3,3-hexafluoropropan-2-yl]cyclohexane |
|---|---|
| PubChem CID | 21053294 |
| Molecular Formula | C24H36F12O4 |
| Molecular Weight | 616.52 g/mol |
| Exact Mass | 616.24 |
| IUPAC Name | 1-butan-2-yl-3,5-bis[2-(1-ethoxyethoxy)-1,1,1,3,3,3-hexafluoropropan-2-yl]cyclohexane |
| SMILES | CCOC(C)OC(C1CC(C(C)CC)CC(C(OC(C)OCC)(C(F)(F)F)C(F)(F)F)C1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C24H36F12O4/c1-7-13(4)16-10-17(19(21(25,26)27,22(28,29)30)39-14(5)37-8-2)12-18(11-16)20(23(31,32)33,24(34,35)36)40-15(6)38-9-3/h13-18H,7-12H2,1-6H3 |
| InChIKey | LJMHCSYQWJBXBT-UHFFFAOYSA-N |
| XLogP | 8.59 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.52 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|