C19H22F12O4 — CID 21053321
[1,1,1,7,7,7-hexafluoro-2,6-dihydroxy-2,6-bis(trifluoromethyl)heptan-4-yl] 5,6-dimethylbicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 21053321) has the molecular formula C19H22F12O4 and a molecular weight of 542.36 g/mol. Its IUPAC name is [1,1,1,7,7,7-hexafluoro-2,6-dihydroxy-2,6-bis(trifluoromethyl)heptan-4-yl] 5,6-dimethylbicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | [1,1,1,7,7,7-hexafluoro-2,6-dihydroxy-2,6-bis(trifluoromethyl)heptan-4-yl] 5,6-dimethylbicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 21053321 |
| Molecular Formula | C19H22F12O4 |
| Molecular Weight | 542.36 g/mol |
| Exact Mass | 542.13 |
| IUPAC Name | [1,1,1,7,7,7-hexafluoro-2,6-dihydroxy-2,6-bis(trifluoromethyl)heptan-4-yl] 5,6-dimethylbicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | CC1C2CC(C(=O)OC(CC(O)(C(F)(F)F)C(F)(F)F)CC(O)(C(F)(F)F)C(F)(F)F)C(C2)C1C |
| InChI | InChI=1S/C19H22F12O4/c1-7-8(2)11-3-9(7)4-12(11)13(32)35-10(5-14(33,16(20,21)22)17(23,24)25)6-15(34,18(26,27)28)19(29,30)31/h7-12,33-34H,3-6H2,1-2H3 |
| InChIKey | PZSKCYBSAYOOBF-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.36 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |