C14H18F6O3 — CID 21053449
5-[[3,3,3-trifluoro-2-(methoxymethoxy)-2-(trifluoromethyl)propoxy]methyl]bicyclo[2.2.1]hept-2-ene (PubChem CID 21053449) has the molecular formula C14H18F6O3 and a molecular weight of 348.28 g/mol. Its IUPAC name is 5-[[3,3,3-trifluoro-2-(methoxymethoxy)-2-(trifluoromethyl)propoxy]methyl]bicyclo[2.2.1]hept-2-ene.
| Compound Name | 5-[[3,3,3-trifluoro-2-(methoxymethoxy)-2-(trifluoromethyl)propoxy]methyl]bicyclo[2.2.1]hept-2-ene |
|---|---|
| PubChem CID | 21053449 |
| Molecular Formula | C14H18F6O3 |
| Molecular Weight | 348.28 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | 5-[[3,3,3-trifluoro-2-(methoxymethoxy)-2-(trifluoromethyl)propoxy]methyl]bicyclo[2.2.1]hept-2-ene |
| SMILES | COCOC(COCC1CC2C=CC1C2)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C14H18F6O3/c1-21-8-23-12(13(15,16)17,14(18,19)20)7-22-6-11-5-9-2-3-10(11)4-9/h2-3,9-11H,4-8H2,1H3 |
| InChIKey | BJEQKWLCESZPAZ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.28 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|