About 4-fluoro-4-methyltetracyclo[6.2.1.13,6.02,7]dodecane
4-fluoro-4-methyltetracyclo[6.2.1.13,6.02,7]dodecane (PubChem CID 21053479) has the molecular formula C13H19F
and a molecular weight of 194.29 g/mol. Its IUPAC name is 4-fluoro-4-methyltetracyclo[6.2.1.13,6.02,7]dodecane.
Molecular Properties
| Compound Name | 4-fluoro-4-methyltetracyclo[6.2.1.13,6.02,7]dodecane |
| PubChem CID | 21053479 |
| Molecular Formula | C13H19F |
| Molecular Weight | 194.29 g/mol |
| Exact Mass | 194.15 |
| IUPAC Name | 4-fluoro-4-methyltetracyclo[6.2.1.13,6.02,7]dodecane |
| SMILES | CC1(F)CC2CC1C1C3CCC(C3)C21 |
| InChI | InChI=1S/C13H19F/c1-13(14)6-9-5-10(13)12-8-3-2-7(4-8)11(9)12/h7-12H,2-6H2,1H3 |
| InChIKey | MYJDXMZBYJTQCK-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.29 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'} |
|---|
Analyze 4-fluoro-4-methyltetracyclo[6.2.1.13,6.02,7]dodecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-4-methyltetracyclo[6.2.1.13,6.02,7]dodecane?
The IUPAC name of 4-fluoro-4-methyltetracyclo[6.2.1.13,6.02,7]dodecane (CID 21053479) is 4-fluoro-4-methyltetracyclo[6.2.1.13,6.02,7]dodecane.
What is the SMILES notation for 4-fluoro-4-methyltetracyclo[6.2.1.13,6.02,7]dodecane?
The canonical SMILES for 4-fluoro-4-methyltetracyclo[6.2.1.13,6.02,7]dodecane is CC1(F)CC2CC1C1C3CCC(C3)C21.
What is the InChIKey of 4-fluoro-4-methyltetracyclo[6.2.1.13,6.02,7]dodecane?
The InChIKey is MYJDXMZBYJTQCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19F/c1-13(14)6-9-5-10(13)12-8-3-2-7(4-8)11(9)12/h7-12H,2-6H2,1H3.
What are the key properties of 4-fluoro-4-methyltetracyclo[6.2.1.13,6.02,7]dodecane?
4-fluoro-4-methyltetracyclo[6.2.1.13,6.02,7]dodecane has a molecular weight of 194.29 g/mol, XLogP of 3.42, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-4-methyltetracyclo[6.2.1.13,6.02,7]dodecane is sourced from PubChem (CID 21053479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).