C11H16F8O3Si — CID 21053488
triethoxy-(1,2,2,3,3,4,4,5-octafluorocyclopentyl)silane (PubChem CID 21053488) has the molecular formula C11H16F8O3Si and a molecular weight of 376.32 g/mol. Its IUPAC name is triethoxy-(1,2,2,3,3,4,4,5-octafluorocyclopentyl)silane.
| Compound Name | triethoxy-(1,2,2,3,3,4,4,5-octafluorocyclopentyl)silane |
|---|---|
| PubChem CID | 21053488 |
| Molecular Formula | C11H16F8O3Si |
| Molecular Weight | 376.32 g/mol |
| Exact Mass | 376.07 |
| IUPAC Name | triethoxy-(1,2,2,3,3,4,4,5-octafluorocyclopentyl)silane |
| SMILES | CCO[Si](OCC)(OCC)C1(F)C(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C11H16F8O3Si/c1-4-20-23(21-5-2,22-6-3)9(15)7(12)8(13,14)10(16,17)11(9,18)19/h7H,4-6H2,1-3H3 |
| InChIKey | YHKDVXBBAYMEAW-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.32 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|