About methyl 2-[2-[2-amino-5-(3,4-dimethyl-2,6-dioxopyrimidin-1-yl)-4-fluorophenoxy]phenoxy]acetate
methyl 2-[2-[2-amino-5-(3,4-dimethyl-2,6-dioxopyrimidin-1-yl)-4-fluorophenoxy]phenoxy]acetate (PubChem CID 21053869) has the molecular formula C21H20FN3O6
and a molecular weight of 429.40 g/mol. Its IUPAC name is methyl 2-[2-[2-amino-5-(3,4-dimethyl-2,6-dioxopyrimidin-1-yl)-4-fluorophenoxy]phenoxy]acetate.
Molecular Properties
| Compound Name | methyl 2-[2-[2-amino-5-(3,4-dimethyl-2,6-dioxopyrimidin-1-yl)-4-fluorophenoxy]phenoxy]acetate |
| PubChem CID | 21053869 |
| Molecular Formula | C21H20FN3O6 |
| Molecular Weight | 429.40 g/mol |
| Exact Mass | 429.13 |
| IUPAC Name | methyl 2-[2-[2-amino-5-(3,4-dimethyl-2,6-dioxopyrimidin-1-yl)-4-fluorophenoxy]phenoxy]acetate |
| SMILES | COC(=O)COc1ccccc1Oc1cc(-n2c(=O)cc(C)n(C)c2=O)c(F)cc1N |
| InChI | InChI=1S/C21H20FN3O6/c1-12-8-19(26)25(21(28)24(12)2)15-10-18(14(23)9-13(15)22)31-17-7-5-4-6-16(17)30-11-20(27)29-3/h4-10H,11,23H2,1-3H3 |
| InChIKey | QXVWFAQAZNYBMC-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 114.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 429.40 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-[2-[2-amino-5-(3,4-dimethyl-2,6-dioxopyrimidin-1-yl)-4-fluorophenoxy]phenoxy]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[2-[2-amino-5-(3,4-dimethyl-2,6-dioxopyrimidin-1-yl)-4-fluorophenoxy]phenoxy]acetate?
The IUPAC name of methyl 2-[2-[2-amino-5-(3,4-dimethyl-2,6-dioxopyrimidin-1-yl)-4-fluorophenoxy]phenoxy]acetate (CID 21053869) is methyl 2-[2-[2-amino-5-(3,4-dimethyl-2,6-dioxopyrimidin-1-yl)-4-fluorophenoxy]phenoxy]acetate.
What is the SMILES notation for methyl 2-[2-[2-amino-5-(3,4-dimethyl-2,6-dioxopyrimidin-1-yl)-4-fluorophenoxy]phenoxy]acetate?
The canonical SMILES for methyl 2-[2-[2-amino-5-(3,4-dimethyl-2,6-dioxopyrimidin-1-yl)-4-fluorophenoxy]phenoxy]acetate is COC(=O)COc1ccccc1Oc1cc(-n2c(=O)cc(C)n(C)c2=O)c(F)cc1N.
What is the InChIKey of methyl 2-[2-[2-amino-5-(3,4-dimethyl-2,6-dioxopyrimidin-1-yl)-4-fluorophenoxy]phenoxy]acetate?
The InChIKey is QXVWFAQAZNYBMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20FN3O6/c1-12-8-19(26)25(21(28)24(12)2)15-10-18(14(23)9-13(15)22)31-17-7-5-4-6-16(17)30-11-20(27)29-3/h4-10H,11,23H2,1-3H3.
What are the key properties of methyl 2-[2-[2-amino-5-(3,4-dimethyl-2,6-dioxopyrimidin-1-yl)-4-fluorophenoxy]phenoxy]acetate?
methyl 2-[2-[2-amino-5-(3,4-dimethyl-2,6-dioxopyrimidin-1-yl)-4-fluorophenoxy]phenoxy]acetate has a molecular weight of 429.40 g/mol, XLogP of 1.91, 6 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[2-[2-amino-5-(3,4-dimethyl-2,6-dioxopyrimidin-1-yl)-4-fluorophenoxy]phenoxy]acetate is sourced from PubChem (CID 21053869), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).