C19H19ClFNO7 — CID 21053879
methyl 2-[2-[2-chloro-5-(3,3-dihydroxybutanoylamino)-4-fluorophenoxy]phenoxy]acetate (PubChem CID 21053879) has the molecular formula C19H19ClFNO7 and a molecular weight of 427.81 g/mol. Its IUPAC name is methyl 2-[2-[2-chloro-5-(3,3-dihydroxybutanoylamino)-4-fluorophenoxy]phenoxy]acetate.
| Compound Name | methyl 2-[2-[2-chloro-5-(3,3-dihydroxybutanoylamino)-4-fluorophenoxy]phenoxy]acetate |
|---|---|
| PubChem CID | 21053879 |
| Molecular Formula | C19H19ClFNO7 |
| Molecular Weight | 427.81 g/mol |
| Exact Mass | 427.08 |
| IUPAC Name | methyl 2-[2-[2-chloro-5-(3,3-dihydroxybutanoylamino)-4-fluorophenoxy]phenoxy]acetate |
| SMILES | COC(=O)COc1ccccc1Oc1cc(NC(=O)CC(C)(O)O)c(F)cc1Cl |
| InChI | InChI=1S/C19H19ClFNO7/c1-19(25,26)9-17(23)22-13-8-16(11(20)7-12(13)21)29-15-6-4-3-5-14(15)28-10-18(24)27-2/h3-8,25-26H,9-10H2,1-2H3,(H,22,23) |
| InChIKey | BTMKPFPISMUMSO-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 114.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.81 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|