About 2,3-dimethyl-6,10-dioxa-2-azaspiro[4.5]decane
2,3-dimethyl-6,10-dioxa-2-azaspiro[4.5]decane (PubChem CID 21054008) has the molecular formula C9H17NO2
and a molecular weight of 171.24 g/mol. Its IUPAC name is 2,3-dimethyl-6,10-dioxa-2-azaspiro[4.5]decane.
Molecular Properties
| Compound Name | 2,3-dimethyl-6,10-dioxa-2-azaspiro[4.5]decane |
| PubChem CID | 21054008 |
| Molecular Formula | C9H17NO2 |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.13 |
| IUPAC Name | 2,3-dimethyl-6,10-dioxa-2-azaspiro[4.5]decane |
| SMILES | CC1CC2(CN1C)OCCCO2 |
| InChI | InChI=1S/C9H17NO2/c1-8-6-9(7-10(8)2)11-4-3-5-12-9/h8H,3-7H2,1-2H3 |
| InChIKey | MEZZEDYELFVFCE-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,3-dimethyl-6,10-dioxa-2-azaspiro[4.5]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethyl-6,10-dioxa-2-azaspiro[4.5]decane?
The IUPAC name of 2,3-dimethyl-6,10-dioxa-2-azaspiro[4.5]decane (CID 21054008) is 2,3-dimethyl-6,10-dioxa-2-azaspiro[4.5]decane.
What is the SMILES notation for 2,3-dimethyl-6,10-dioxa-2-azaspiro[4.5]decane?
The canonical SMILES for 2,3-dimethyl-6,10-dioxa-2-azaspiro[4.5]decane is CC1CC2(CN1C)OCCCO2.
What is the InChIKey of 2,3-dimethyl-6,10-dioxa-2-azaspiro[4.5]decane?
The InChIKey is MEZZEDYELFVFCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO2/c1-8-6-9(7-10(8)2)11-4-3-5-12-9/h8H,3-7H2,1-2H3.
What are the key properties of 2,3-dimethyl-6,10-dioxa-2-azaspiro[4.5]decane?
2,3-dimethyl-6,10-dioxa-2-azaspiro[4.5]decane has a molecular weight of 171.24 g/mol, XLogP of 0.84, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethyl-6,10-dioxa-2-azaspiro[4.5]decane is sourced from PubChem (CID 21054008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).