C19H23FN4OS2 — CID 2105401
(2R)-N-[2-(cyclohexen-1-yl)ethyl]-2-[[5-(2-fluoroanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]propanamide (PubChem CID 2105401) has the molecular formula C19H23FN4OS2 and a molecular weight of 406.55 g/mol. Its IUPAC name is (2R)-N-[2-(cyclohexen-1-yl)ethyl]-2-[[5-(2-fluoroanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]propanamide.
| Compound Name | (2R)-N-[2-(cyclohexen-1-yl)ethyl]-2-[[5-(2-fluoroanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]propanamide |
|---|---|
| PubChem CID | 2105401 |
| Molecular Formula | C19H23FN4OS2 |
| Molecular Weight | 406.55 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | (2R)-N-[2-(cyclohexen-1-yl)ethyl]-2-[[5-(2-fluoroanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]propanamide |
| SMILES | C[C@@H](Sc1nnc(Nc2ccccc2F)s1)C(=O)NCCC1=CCCCC1 |
| InChI | InChI=1S/C19H23FN4OS2/c1-13(17(25)21-12-11-14-7-3-2-4-8-14)26-19-24-23-18(27-19)22-16-10-6-5-9-15(16)20/h5-7,9-10,13H,2-4,8,11-12H2,1H3,(H,21,25)(H,22,23)/t13-/m1/s1 |
| InChIKey | BSQPLPHWGHVZDG-CYBMUJFWSA-N |
| XLogP | 4.91 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.55 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|